For research use only. Not for therapeutic Use.
LY900009 (CAT: I007893) is a small molecule inhibitor that selectively targets the γ-secretase protein, leading to the inhibition of Notch signaling. This inhibition has been shown to have a dose-dependent effect on plasma levels of amyloid-β peptide, with significant reductions observed in the 30- to 60-mg dose ranges. By targeting the γ-secretase protein, LY900009 aims to modulate the processing of amyloid-β and potentially impact the underlying mechanisms involved in diseases such as Alzheimer’s.
| Catalog Number | I007893 |
| CAS Number | 209984-68-9 |
| Synonyms | LY900009; LY-900009; LY 900009.;(S)-2-hydroxy-3-methyl-N-((S)-1-(((S)-5-methyl-6-oxo-6,7-dihydro-5H-dibenzo[b,d]azepin-7-yl)amino)-1-oxopropan-2-yl)butanamide |
| Molecular Formula | C23H27N3O4 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Solubility | Soluble in DMSO, not in water |
| Storage | Store at -20°C |
| IUPAC Name | (2S)-2-hydroxy-3-methyl-N-[(2S)-1-[[(7S)-5-methyl-6-oxo-7H-benzo[d][1]benzazepin-7-yl]amino]-1-oxopropan-2-yl]butanamide |
| InChI | InChI=1S/C23H27N3O4/c1-13(2)20(27)22(29)24-14(3)21(28)25-19-17-11-6-5-9-15(17)16-10-7-8-12-18(16)26(4)23(19)30/h5-14,19-20,27H,1-4H3,(H,24,29)(H,25,28)/t14-,19-,20-/m0/s1 |
| InChIKey | JURYTIUJMYPBNN-GKCIPKSASA-N |
| SMILES | CC(C)C(C(=O)NC(C)C(=O)NC1C2=CC=CC=C2C3=CC=CC=C3N(C1=O)C)O |
| Reference | 1: Pant S, Jones SF, Kurkjian CD, Infante JR, Moore KN, Burris HA, McMeekin DS, |
