For research use only. Not for therapeutic Use.
Lycopene is a naturally occurring carotenoid, a type of pigment responsible for the red and pink color in fruits and vegetables such as tomatoes, watermelon, and pink grapefruit. It is a powerful antioxidant, known for its potential health benefits, including reducing the risk of certain chronic diseases like heart disease and some cancers. Lycopene is fat-soluble and is more easily absorbed by the body when consumed with fat-containing foods. It has also been studied for its role in skin protection against UV damage and in promoting overall cellular health.
Catalog Number | R002801 |
CAS Number | 502-65-8 |
Synonyms | ψ,ψ-Carotene; all-trans-Lycopene; C.I. 75125; Lyco Vit; Lycopene 7; Lycored; NSC 407322; Redivivo; all-trans-Lycopene; trans-Lycopene;? |
Molecular Formula | C40H56 |
Purity | ≥95% |
Target | NF-κB |
Storage | -80°C |
InChI | InChI=1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+ |
InChIKey | OAIJSZIZWZSQBC-GYZMGTAESA-N |
SMILES | CC(=CCC/C(=C/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C=C(/CCC=C(C)C)\C)\C)\C)/C)/C)/C)C |