For research use only. Not for therapeutic Use.
Lycorenine(Cat No.:R072604)is an alkaloid found in the Amaryllidaceae family, particularly in plants like Lycoris radiata. Known for its vasodilatory and hypotensive effects, it has been studied for its potential cardiovascular benefits. Lycorenine exhibits inhibitory effects on smooth muscle contractions, which contributes to its ability to lower blood pressure. Additionally, it possesses mild anti-inflammatory and antioxidant properties, expanding its research interest in natural compound studies. Its pharmacological profile makes Lycorenine significant in traditional medicine and scientific research exploring plant-based treatments for cardiovascular health and related disorders.
CAS Number | 477-19-0 |
Molecular Formula | C18H23NO4 |
Purity | ≥95% |
Target | Bacterial |
IUPAC Name | (5aR,7S,11bS,11cS)-9,10-dimethoxy-1-methyl-3,5,5a,7,11b,11c-hexahydro-2H-isochromeno[3,4-g]indol-7-ol |
InChI | InChI=1S/C18H23NO4/c1-19-7-6-10-4-5-13-16(17(10)19)11-8-14(21-2)15(22-3)9-12(11)18(20)23-13/h4,8-9,13,16-18,20H,5-7H2,1-3H3/t13-,16-,17-,18+/m1/s1 |
InChIKey | VHYYSQODIQWPDO-PILAGYSTSA-N |
SMILES | CN1CCC2=CC[C@@H]3[C@H]([C@@H]21)C4=CC(=C(C=C4[C@H](O3)O)OC)OC |