For research use only. Not for therapeutic Use.
Lycorine hydrochloride (Cat.No:I002671) is a natural alkaloid derived from various plants of the Amaryllidaceae family. It possesses a wide range of pharmacological activities, including anticancer, antiviral, and antimalarial properties. Lycorine hydrochloride has been studied for its potential in cancer therapy and as an antiviral agent against viruses such as HIV and hepatitis C.
| Catalog Number | I002671 |
| CAS Number | 2188-68-3 |
| Molecular Formula | C16H18ClNO4 |
| Purity | ≥95% |
| Target | Anti-infection |
| Solubility | DMSO ≥ 31 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | (1S,17S,18S,19S)-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9,15-tetraene-17,18-diol;hydrochloride |
| InChI | InChI=1S/C16H17NO4.ClH/c18-11-3-8-1-2-17-6-9-4-12-13(21-7-20-12)5-10(9)14(15(8)17)16(11)19;/h3-5,11,14-16,18-19H,1-2,6-7H2;1H/t11-,14-,15+,16+;/m0./s1 |
| InChIKey | VUVNTYCHKZBOMV-NVJKKXITSA-N |
| SMILES | C1CN2CC3=CC4=C(C=C3C5C2C1=CC(C5O)O)OCO4.Cl |
