For research use only. Not for therapeutic Use.
Lysergamide is a chemical compound structurally related to lysergic acid and found in certain psychedelic substances. It forms the backbone of notable hallucinogens like LSD (lysergic acid diethylamide). Lysergamides are known for their potent psychoactive effects, which include altered perception, mood changes, and cognitive shifts. These compounds interact with serotonin receptors in the brain, leading to their psychedelic properties. They are subjects of scientific interest for their potential therapeutic applications and their profound impact on human consciousness.
| Catalog Number | R046434 |
| CAS Number | 478-94-4 |
| Synonyms | (8β)-9,10-Didehydro-6-methylergoline-8-carboxamide; (+)-Lysergamide; D-Lysergic Acid Amide; Ergine; Lysergic Acid Amide; |
| Molecular Formula | C16H17N3O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (6aR,9R)-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
| InChI | InChI=1S/C16H17N3O/c1-19-8-10(16(17)20)5-12-11-3-2-4-13-15(11)9(7-18-13)6-14(12)19/h2-5,7,10,14,18H,6,8H2,1H3,(H2,17,20)/t10-,14-/m1/s1 |
| InChIKey | GENAHGKEFJLNJB-QMTHXVAHSA-N |
| SMILES | CN1CC(C=C2C1CC3=CNC4=CC=CC2=C34)C(=O)N |
