For research use only. Not for therapeutic Use.
Lysophosphatidylcholines (Cat No.:R067984) are a class of phospholipids formed when the fatty acid group is removed from phosphatidylcholine. These molecules play crucial roles in cellular signaling, membrane dynamics, and inflammation. LPCs are involved in various biological processes, including modulating cell membrane fluidity, promoting cell migration, and influencing immune responses. Elevated levels of LPCs have been associated with conditions such as cardiovascular diseases, neuroinflammation, and certain cancers. Due to their bioactive properties, LPCs are being studied for their potential therapeutic applications in modulating inflammatory pathways and improving cardiovascular health.
| CAS Number | 9008-30-4 |
| Purity | ≥95% |
| IUPAC Name | [(2R)-3-acetyloxy-2-hydroxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| InChI | InChI=1S/C10H22NO7P/c1-9(12)16-7-10(13)8-18-19(14,15)17-6-5-11(2,3)4/h10,13H,5-8H2,1-4H3/t10-/m1/s1 |
| InChIKey | RYCNUMLMNKHWPZ-SNVBAGLBSA-N |
| SMILES | CC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
