For research use only. Not for therapeutic Use.
Lysyl hydroxylase 2-IN-1(CAT: I040722) is a potent and selective small-molecule inhibitor targeting lysyl hydroxylase 2 (LH2), an enzyme crucial for collagen cross-linking and extracellular matrix remodeling. By inhibiting LH2 activity, this compound disrupts abnormal collagen stabilization, offering therapeutic potential in fibrosis, cancer metastasis, and other pathologies involving excessive tissue remodeling. Lysyl hydroxylase 2-IN-1 is a valuable research tool for studying LH2-related pathways and evaluating antifibrotic drug candidates. Its high specificity and efficacy make it suitable for preclinical studies aimed at modulating collagen biosynthesis and investigating novel strategies in tissue fibrosis, tumor progression, and inflammatory diseases.
| Synonyms | 1-(3-morpholin-4-ylphenyl)-3-pyridin-4-ylpropane-1,3-dione |
| Molecular Formula | C18H18N2O3 |
| Purity | ≥95% |
| IUPAC Name | 1-(3-morpholin-4-ylphenyl)-3-pyridin-4-ylpropane-1,3-dione |
| InChI | InChI=1S/C18H18N2O3/c21-17(14-4-6-19-7-5-14)13-18(22)15-2-1-3-16(12-15)20-8-10-23-11-9-20/h1-7,12H,8-11,13H2 |
| InChIKey | XWEDKEPGOROEEE-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=CC(=C2)C(=O)CC(=O)C3=CC=NC=C3 |
