For research use only. Not for therapeutic Use.
Lysyl threonine is a dipeptide composed of the amino acids lysine and threonine, linked by a peptide bond. Lysine, an essential amino acid, contains a positively charged amine group, while threonine has a hydroxyl (-OH) group in its side chain. This structure allows lysyl threonine to participate in various biochemical processes, such as protein synthesis and regulation. It may also be of interest in peptide-based drug development, with potential applications in therapeutic treatments related to metabolic or neurological disorders.
| Catalog Number | I031336 |
| CAS Number | 97791-84-9 |
| Synonyms | Lysyl threonine; Dipeptide KT; Dipeptide-7; L-Threonine, l-lysyl- ; |
| Molecular Formula | C10H21N3O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | L-lysyl-L-threonine |
| InChI | InChI=1S/C10H21N3O4/c1-6(14)8(10(16)17)13-9(15)7(12)4-2-3-5-11/h6-8,14H,2-5,11-12H2,1H3,(H,13,15)(H,16,17)/t6-,7+,8+/m1/s1 |
| InChIKey | ZOKVLMBYDSIDKG-CSMHCCOUSA-N |
| SMILES | C[C@@H](O)[C@@H](C(O)=O)NC([C@H](CCCCN)N)=O |
