For research use only. Not for therapeutic Use.
Lysyllysine(Cat No.:M065212) is a compound formed by the cross-linking of two lysine residues in a protein chain. This process, known as lysyl lysine formation or lysine cross-linking, occurs through enzymatic or non-enzymatic mechanisms. Lysyllysine plays a crucial role in stabilizing the structure of certain proteins, particularly in extracellular matrices like collagen and elastin. These cross-links enhance the strength, stability, and elasticity of connective tissues, contributing to the integrity of skin, tendons, and blood vessels.
CAS Number | 13184-13-9 |
Synonyms | lysyllysine |
Molecular Formula | C12H26N4O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2S)-6-amino-2-[[(2S)-2,6-diaminohexanoyl]amino]hexanoic acid |
InChI | InChI=1S/C12H26N4O3/c13-7-3-1-5-9(15)11(17)16-10(12(18)19)6-2-4-8-14/h9-10H,1-8,13-15H2,(H,16,17)(H,18,19)/t9-,10-/m0/s1 |
InChIKey | NVGBPTNZLWRQSY-UWVGGRQHSA-N |
SMILES | C(CCN)CC(C(=O)NC(CCCCN)C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |