For research use only. Not for therapeutic Use.
LZWL02003(CAT: I040782) is a promising anti-neuroinflammatory agent with demonstrated neuroprotective properties. It effectively protects against MPP⁺-induced neuronal damage by reducing reactive oxygen species (ROS) levels, thereby mitigating oxidative stress. In a Rotenone-induced Parkinson’s disease (PD) rat model, LZWL02003 significantly improves cognition, memory, learning, and motor function, highlighting its therapeutic potential in neurodegenerative disease research. Its dual action in reducing inflammation and oxidative damage makes it a valuable tool for studying the mechanisms of Parkinson’s disease, Alzheimer’s disease, and other CNS disorders. LZWL02003 offers a potential pathway for developing treatments aimed at slowing or reversing neurodegeneration.
| CAS Number | 1371564-45-2 |
| Synonyms | 2-hydroxy-N-[2-(1H-indol-3-yl)ethyl]-4-methylbenzamide |
| Molecular Formula | C18H18N2O2 |
| Purity | ≥95% |
| IUPAC Name | 2-hydroxy-N-[2-(1H-indol-3-yl)ethyl]-4-methylbenzamide |
| InChI | InChI=1S/C18H18N2O2/c1-12-6-7-15(17(21)10-12)18(22)19-9-8-13-11-20-16-5-3-2-4-14(13)16/h2-7,10-11,20-21H,8-9H2,1H3,(H,19,22) |
| InChIKey | IIXQVHOWQHXBKW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)NCCC2=CNC3=CC=CC=C32)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
