For research use only. Not for therapeutic Use.
m-3M3FBS(Cat No.:R024960)is a powerful phospholipase C (PLC) activator with various cellular effects. It triggers the production of superoxide in human neutrophils, enhances intracellular calcium ion levels, and stimulates phosphoinositide production in diverse cell types. Additionally, m-3M3FBS induces apoptosis, a programmed cell death, in monocytic leukemia cells. Its ability to modulate these intracellular signaling pathways makes it a valuable tool in cellular research and potential therapeutic applications for diseases involving PLC activation or apoptosis induction.
CAS Number | 200933-14-8 |
Synonyms | 2,4,6-Trimethyl-N-[3-(trifluoromethyl)phenyl]-benzenesulfonamide |
Molecular Formula | C16H16F3NO2S |
Purity | ≥95% |
Target | Apoptosis |
Solubility | Soluble in DMSO > 10 mM |
Storage | Store at RT |
IUPAC Name | 2,4,6-trimethyl-N-[3-(trifluoromethyl)phenyl]benzenesulfonamide |
InChI | InChI=1S/C16H16F3NO2S/c1-10-7-11(2)15(12(3)8-10)23(21,22)20-14-6-4-5-13(9-14)16(17,18)19/h4-9,20H,1-3H3 |
InChIKey | ZIIUUSVHCHPIQD-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NC2=CC=CC(=C2)C(F)(F)F)C |