For research use only. Not for therapeutic Use.
m-Anisidine, 4-((5-(phenylthio)pentyl)oxy)-(Cat No.:I031506)is a chemical compound with a structure that combines an anisidine group (methoxyphenylamine) with a phenylthio-pentyl ether moiety. This compound has potential applications in organic synthesis and material science, where its functional groups may serve as intermediates for creating more complex molecules. The phenylthio group could contribute to improved solubility or stability in certain environments, while the anisidine structure may allow for specific reactivity in chemical reactions. It may also be explored in research related to molecular electronics, sensors, or other fields requiring tailored molecular interactions.
CAS Number | 107779-28-2 |
Synonyms | m-Anisidine, 4-((5-(phenylthio)pentyl)oxy)- |
Molecular Formula | C18H23NO2S |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 3-methoxy-4-(5-phenylsulfanylpentoxy)aniline |
InChI | InChI=1S/C18H23NO2S/c1-20-18-14-15(19)10-11-17(18)21-12-6-3-7-13-22-16-8-4-2-5-9-16/h2,4-5,8-11,14H,3,6-7,12-13,19H2,1H3 |
InChIKey | VUQTUYGZKQZJJK-UHFFFAOYSA-N |
SMILES | COC1=C(C=CC(=C1)N)OCCCCCSC2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |