For research use only. Not for therapeutic Use.
m-Cyanoacetophenone (Cat.No:R063733) is a chemical compound used in organic synthesis for its versatile reactivity. It contains both a cyano group and a ketone, making it valuable in the creation of complex molecules, especially pharmaceuticals and agrochemicals. Its unique structure lends itself to a range of synthetic applications.
CAS Number | 6136-68-1 |
Synonyms | 3-Acetyl-benzonitrile; m-Acetyl-benzonitrile; 1-(3-Cyanophenyl)ethanone; 3-Acetylbenzonitrile; 3’-Cyanoacetophenone; NSC 210360; |
Molecular Formula | C9H7NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-acetylbenzonitrile |
InChI | InChI=1S/C9H7NO/c1-7(11)9-4-2-3-8(5-9)6-10/h2-5H,1H3 |
InChIKey | SBCFGFDAZCTSRH-UHFFFAOYSA-N |
SMILES | CC(=O)C1=CC=CC(=C1)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |