For research use only. Not for therapeutic Use.
m-Cyanoacetophenone (Cat.No:R063733) is a chemical compound used in organic synthesis for its versatile reactivity. It contains both a cyano group and a ketone, making it valuable in the creation of complex molecules, especially pharmaceuticals and agrochemicals. Its unique structure lends itself to a range of synthetic applications.
| Catalog Number | R063733 |
| CAS Number | 6136-68-1 |
| Synonyms | 3-Acetyl-benzonitrile; m-Acetyl-benzonitrile; 1-(3-Cyanophenyl)ethanone; 3-Acetylbenzonitrile; 3’-Cyanoacetophenone; NSC 210360; |
| Molecular Formula | C9H7NO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-acetylbenzonitrile |
| InChI | InChI=1S/C9H7NO/c1-7(11)9-4-2-3-8(5-9)6-10/h2-5H,1H3 |
| InChIKey | SBCFGFDAZCTSRH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC(=C1)C#N |
