For research use only. Not for therapeutic Use.
m-Formylbenzonitrile(Cat No.:I032216) is a bioactive chemical compound with potential pharmacological activities. It is a formyl-substituted benzonitrile derivative. Due to its unique chemical structure, m-Formylbenzonitrile may exhibit diverse biological effects depending on the specific context and target system. Its bioactivity and mechanisms of action can vary, making it important to consider the specific research or therapeutic application for a comprehensive understanding of its potential effects.
CAS Number | 24964-64-5 |
Synonyms | m-Formylbenzonitrile |
Molecular Formula | C8H5NO |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Room Temperature |
IUPAC Name | m-Formylbenzonitrile |
InChI | InChI=1S/C8H5NO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,6H |
InChIKey | HGZJJKZPPMFIBU-UHFFFAOYSA-N |
SMILES | N#CC1=CC=CC(C=O)=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |