For research use only, not for therapeutic use.
m-Methoxybenzamide(Cat No.:R070731)is an aromatic amide compound widely used in organic synthesis and pharmaceutical research. Featuring a methoxy group positioned meta to the amide functionality, this compound exhibits interesting biological properties, making it a valuable intermediate in drug development. Its ability to participate in various chemical reactions, such as acylation and amination, enables the synthesis of more complex molecules. Additionally, m-Methoxybenzamide serves as a key building block for creating diverse derivatives with potential therapeutic applications. Its stability and reactivity enhance its utility in medicinal chemistry and chemical research.
Catalog Number | R070731 |
CAS Number | 5813-86-5 |
Synonyms | m-Anisamide |
Molecular Formula | C8H9NO2 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 3-methoxybenzamide |
InChI | InChI=1S/C8H9NO2/c1-11-7-4-2-3-6(5-7)8(9)10/h2-5H,1H3,(H2,9,10) |
InChIKey | VKPLPDIMEREJJF-UHFFFAOYSA-N |
SMILES | COC1=CC=CC(=C1)C(=O)N |