For research use only. Not for therapeutic Use.
m-(Methylamino)phenol (Cat.No:M056268) is a chemical compound used in the production of dyes and pigments. Its unique chemical structure includes a methylamino group attached to a phenolic ring, which makes it valuable as a building block in the synthesis of colorants used in textiles, inks, and other industries.
CAS Number | 14703-69-6 |
Molecular Formula | C7H9NO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-(methylamino)phenol |
InChI | InChI=1S/C7H9NO/c1-8-6-3-2-4-7(9)5-6/h2-5,8-9H,1H3 |
InChIKey | KLLOEOPUXBJSOW-UHFFFAOYSA-N |
SMILES | CNC1=CC(=CC=C1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |