For research use only. Not for therapeutic Use.
m-Nitrobenzamide is an organic compound featuring a nitro group (-NO2) at the meta position of a benzene ring and an amide group (-CONH2). This compound is of interest in organic synthesis and medicinal chemistry due to its functional groups, which enable further chemical modifications. It is often used as a building block for the development of pharmaceuticals, agrochemicals, and dyes. Researchers explore its reactivity and potential bioactivity in creating compounds with antimicrobial, anticancer, or anti-inflammatory properties.
| Catalog Number | R070816 |
| CAS Number | 645-09-0 |
| Synonyms | 3-Nitrobenzamide |
| Molecular Formula | C7H6N2O3 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 3-nitrobenzamide |
| InChI | InChI=1S/C7H6N2O3/c8-7(10)5-2-1-3-6(4-5)9(11)12/h1-4H,(H2,8,10) |
| InChIKey | KWAYEPXDGHYGRW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C(=O)N |
