For research use only. Not for therapeutic Use.
m-PEG2-Tos（Cat No.:I017195） is a non-cleavable ADC linker commonly employed in the synthesis of antibody-drug conjugates (ADCs). This linker is designed to stably connect the antibody and the cytotoxic payload, ensuring the controlled release of the drug at the target site. Additionally, m-PEG2-Tos can serve as a linker for PROTAC synthesis. PROTACs are bifunctional molecules that target specific proteins for degradation, and m-PEG2-Tos can facilitate the conjugation of the protein-targeting ligand and the E3 ligase ligand in PROTAC development.
| Catalog Number | I017195 |
| CAS Number | 50586-80-6 |
| Molecular Formula | C₁₂H₁₈O₅S |
| Purity | ≥95% |
| Target | PROTAC |
| Related CAS | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOC |
| IUPAC Name | 2-(2-methoxyethoxy)ethyl 4-methylbenzenesulfonate |
| InChIKey | InChI=1S/C12H18O5S/c1-11-3-5-12(6-4-11)18(13,14)17-10-9-16-8-7-15-2/h3-6H,7-10H2,1-2H3 |
| SMILES | PBKGNJXLJQARIN-UHFFFAOYSA-N |
