For research use only. Not for therapeutic Use.
m-PEG3-O-benzaldehyde(CAT: I015852) is a PEG-based PROTAC linker designed for use in the synthesis of PROTACs (Proteolysis Targeting Chimeras). This linker features a methoxy-polyethylene glycol (PEG3) spacer with an O-benzaldehyde functional group, offering flexibility and solubility in biological environments. In PROTAC design, it connects two ligands: one that binds to an E3 ubiquitin ligase and another that targets the protein of interest. This configuration facilitates the recruitment of the ubiquitin-proteasome system, leading to the selective ubiquitination and degradation of the target protein. m-PEG3-O-benzaldehyde is essential in advancing targeted protein degradation in drug discovery.
| Catalog Number | I015852 |
| CAS Number | 153364-63-7 |
| Molecular Formula | C₁₄H₂₀O₅ |
| Purity | ≥95% |
| Target | PROTAC Linkers |
| IUPAC Name | 4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]benzaldehyde |
| InChI | InChI=1S/C14H20O5/c1-16-6-7-17-8-9-18-10-11-19-14-4-2-13(12-15)3-5-14/h2-5,12H,6-11H2,1H3 |
| InChIKey | HBUXIDOVXGFYFZ-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOC1=CC=C(C=C1)C=O |
