For research use only. Not for therapeutic Use.
m-PEG3-CH2CH2COOH（Cat No.:I016704） is a non-cleavable ADC linker employed in the synthesis of antibody-drug conjugates (ADCs). It acts as a bridge between the antibody and the cytotoxic drug, enabling targeted drug delivery to cancer cells. Additionally, m-PEG3-CH2CH2COOH serves as a PEG-based PROTAC linker, contributing to the synthesis of PROTACs (proteolysis-targeting chimeras). PROTACs are molecules designed to target specific proteins for degradation. The utilization of m-PEG3-CH2CH2COOH in both ADCs and PROTACs highlights its versatility and importance in the development of targeted therapeutics.
| Catalog Number | I016704 |
| CAS Number | 67319-28-2 |
| Molecular Formula | C₁₀H₂₀O₆ |
| Purity | ≥95% |
| Target | PROTAC |
| Storage | 2-8°C |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C10H20O6/c1-13-4-5-15-8-9-16-7-6-14-3-2-10(11)12/h2-9H2,1H3,(H,11,12) |
| InChIKey | ZMCJTXKSDDFJRG-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCC(=O)O |
| Reference | [1]. Robert Lyon, et al. Pegylated drug-linkers for improved ligand-drug conjugate pharmacokinetics. WO2015057699A2. |
