For research use only. Not for therapeutic Use.
m-PEG3-CH2COOH(Cat No.:I016997), is a chemical compound used in various applications, particularly in the field of chemistry and biochemistry. It consists of a methoxy polyethylene glycol (PEG) chain with three ethylene glycol units (hence “m-PEG3”) attached to a carboxylic acid functional group (CH2COOH). This compound is valued for its ability to modify and enhance the solubility, stability, and bioavailability of various molecules, making it a crucial tool in drug delivery, chemical synthesis, and biomaterials science.
CAS Number | 16024-60-5 |
Molecular Formula | C₉H₁₈O₆ |
Purity | ≥95% |
Target | PROTAC Linkers |
IUPAC Name | 2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]acetic acid |
InChI | InChI=1S/C9H18O6/c1-12-2-3-13-4-5-14-6-7-15-8-9(10)11/h2-8H2,1H3,(H,10,11) |
InChIKey | BCGLNCAVZDQPGE-UHFFFAOYSA-N |
SMILES | COCCOCCOCCOCC(=O)O |
Reference | [1]. Chen X, et al. Histidine-Specific Peptide Modification via Visible-Light-Promoted C-H Alkylation. J Am Chem Soc. 2019 Nov 13;141(45):18230-18237. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |