For research use only. Not for therapeutic Use.
m-PEG4-CH2COOH is a PEG-based based PROTAC linker can be used in the synthesis of PROTACs.
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins.
| Catalog Number | M087276 |
| CAS Number | 16024-66-1 |
| Synonyms | 2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]acetic acid |
| Molecular Formula | C11H22O7 |
| Purity | ≥95% |
| InChI | InChI=1S/C11H22O7/c1-14-2-3-15-4-5-16-6-7-17-8-9-18-10-11(12)13/h2-10H2,1H3,(H,12,13) |
| InChIKey | DDTZAHIJJCRGFT-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCC(=O)O |
| Reference | [1]. TaoDeng, et al. Monodisperse oligoethylene glycols modified Propofol prodrugs. Bioorganic & Medicinal Chemistry Letters. |
