For research use only. Not for therapeutic Use.
m-PEG6-azide (Cat.No:I017228) is a versatile chemical compound used in bioconjugation and click chemistry applications. It consists of a methoxy polyethylene glycol (m-PEG) chain with an azide functional group at the terminus. m-PEG6-azide is commonly employed for the modification of biomolecules and surfaces through click reactions, enabling the attachment of various molecules, probes, or tags for biological studies and drug delivery systems.
| Catalog Number | I017228 |
| CAS Number | 1043884-49-6 |
| Molecular Formula | C₁₃H₂₇N₃O₆ |
| Purity | ≥95% |
| Target | ADC Linker |
| IUPAC Name | 1-azido-2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethane |
| InChI | InChI=1S/C13H27N3O6/c1-17-4-5-19-8-9-21-12-13-22-11-10-20-7-6-18-3-2-15-16-14/h2-13H2,1H3 |
| InChIKey | MACROZUHOZGXJL-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| Reference | [1]. Gauzy, Laurence, et al. Cytotoxic agents comprising new tomaymycin derivatives and their therapeutic use. Patent WO2007085930A1. |
