For research use only. Not for therapeutic Use.
m-PEG6-O-CH2COOH is a polyethylene glycol (PEG) derivative featuring six ethylene glycol units and a terminal carboxylic acid group. This compound is commonly used in bioconjugation, drug delivery systems, and surface modification due to the PEG chain’s ability to enhance solubility, reduce immunogenicity, and increase circulation time of therapeutic agents. The carboxyl group provides a reactive site for coupling to various molecules, including peptides, proteins, and drugs, making it valuable in the development of advanced biomedical and pharmaceutical applications.
CAS Number | 75427-75-7 |
Molecular Formula | C₁₅H₃₀O₉ |
Purity | ≥95% |
Target | PROTAC Linkers |
IUPAC Name | 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
InChI | 1S/C15H30O9/c1-18-2-3-19-4-5-20-6-7-21-8-9-22-10-11-23-12-13-24-14-15(16)17/h2-14H2,1H3,(H,16,17) |
InChIKey | AWSXISOALMMMQQ-UHFFFAOYSA-N |
SMILES | COCCOCCOCCOCCOCCOCCOCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |