For research use only. Not for therapeutic Use.
m-PEG7-CH2CH2COOH（Cat No.:I017045） is a non-cleavable linker commonly employed in the synthesis of antibody-drug conjugates (ADCs). This linker consists of a polyethylene glycol (PEG) spacer of seven ethylene glycol units connected to a carboxylic acid group. In addition to its utility in ADCs, m-PEG7-CH2CH2COOH serves as a PEG-based linker for PROTACs (proteolysis-targeting chimeras). Its compatibility with both ADC and PROTAC synthesis highlights its versatility in facilitating the conjugation of therapeutic agents to target proteins for enhanced drug delivery and targeted protein degradation strategies.
| Catalog Number | I017045 |
| CAS Number | 1093647-41-6 |
| Molecular Formula | C₁₈H₃₆O₁₀ |
| Purity | ≥95% |
| Target | PROTAC |
| Storage | -20°C |
| IUPAC Name | 3-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C18H36O10/c1-21-4-5-23-8-9-25-12-13-27-16-17-28-15-14-26-11-10-24-7-6-22-3-2-18(19)20/h2-17H2,1H3,(H,19,20) |
| InChIKey | JHUSQXBQANBSDC-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
| Reference | [1]. Tinya Abrams, et al. Antibody drug conjugates. WO2016203432A1. |
