For research use only. Not for therapeutic Use.
m-Ranolazine (Cat No.:C000741) is an isoform of ranolazine, a medication primarily used to treat chronic angina and certain heart conditions. It works by inhibiting the late sodium current in cardiac cells, leading to reduced intracellular sodium levels, which can help improve cardiac function and reduce ischemic events. m-Ranolazine is likely a derivative or analog of the original compound, with potential modifications to enhance its pharmacological properties. Research involving m-Ranolazine may aim to optimize its therapeutic effects, minimize side effects, or explore its potential applications in treating various cardiovascular disorders, contributing to advancements in cardiology and drug development.
| Catalog Number | C000741 |
| CAS Number | 1393717-46-8 |
| Synonyms | N-(2,6-Dimethylphenyl)-4-[2-hydroxy-3-(3-methoxyphenoxy)propyl]-1-piperazineacetamide |
| Molecular Formula | C₂₄H₃₃N₃O₄ |
| Purity | ≥95% |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Appearance | Off-White to Light Yellow Sticky Solid |
| Storage | -20°C |
| IUPAC Name | N-(2,6-dimethylphenyl)-2-[4-[2-hydroxy-3-(3-methoxyphenoxy)propyl]piperazin-1-yl]acetamide |
| InChI | InChI=1S/C24H33N3O4/c1-18-6-4-7-19(2)24(18)25-23(29)16-27-12-10-26(11-13-27)15-20(28)17-31-22-9-5-8-21(14-22)30-3/h4-9,14,20,28H,10-13,15-17H2,1-3H3,(H,25,29) |
| InChIKey | IMZMNTQZVWHTMZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)CN2CCN(CC2)CC(COC3=CC=CC(=C3)OC)O |
| Reference | Chaitman, B.R., et al.: J. Am. Coll. Cardial., 43, 1375 (2004), McCormack, J.G., et al.: Gen. Pharmacol., 30, 639 (1998), Schofield, J.A.H., et al.: Expert Opin. Invest. Drugs, 11, 117 (2002), |
