For research use only. Not for therapeutic Use.
m-Toluidine（Cat No.:R029191）, also known as 3-aminotoluene, is an aromatic amine derived from toluene by substituting an amino group at the meta position relative to the methyl group. This simple structure forms the backbone for more complex chemical syntheses, particularly in the dye and polymer industries. m-Toluidine is crucial in the manufacture of azo dyes and is also used as a precursor for various agrochemicals and pharmaceuticals. However, it must be handled with care due to its toxicity and potential health risks, necessitating proper safety measures in industrial settings.
| Catalog Number | R029191 |
| CAS Number | 108-44-1 |
| Synonyms | m-Methylphenyl)amine; 1-Amino-3-methylbenzene; 3-Aminophenylmethane; 3-Aminotoluene; 3-Methylaniline; 3- Methylbenzenamine; 3-Methylphenylamine; 3-Toluidine; NSC 15349; m-Aminotoluene; m-Methylaniline; m-Tolylamine |
| Molecular Formula | C7H9N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-methylaniline |
| InChI | InChI=1S/C7H9N/c1-6-3-2-4-7(8)5-6/h2-5H,8H2,1H3 |
| InChIKey | JJYPMNFTHPTTDI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N |
