For research use only. Not for therapeutic Use.
m-Tolylacetic acid(CAT: R069871) is an organic compound consisting of a tolyl (methylphenyl) group attached to an acetic acid moiety, with the methyl group positioned at the meta (3rd) position on the benzene ring. This compound is used as an intermediate in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals. Its carboxylic acid group makes it reactive in esterification, amidation, and coupling reactions, while the tolyl group enhances its hydrophobicity and reactivity. m-Tolylacetic acid is commonly used in the development of bioactive molecules, contributing to its importance in medicinal chemistry and organic synthesis.
| CAS Number | 621-36-3 |
| Synonyms | 3-METHYLPHENYLACETIC ACID |
| Molecular Formula | C9H10O2 |
| Purity | ≥95% |
| Target | Drug Metabolite |
| Storage | RT |
| IUPAC Name | 2-(3-methylphenyl)acetic acid |
| InChI | InChI=1S/C9H10O2/c1-7-3-2-4-8(5-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | GJMPSRSMBJLKKB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
