For research use only. Not for therapeutic Use.
m-Xylene-d10(Cat No.:M028811)is a high-purity, fully deuterated solvent essential for advanced chemical and pharmaceutical research. This isotopically labeled version of m-Xylene, featuring ten deuterium atoms, is crucial for studies on reaction mechanisms, solvent effects, and NMR spectroscopy. The stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of experimental data. Ideal for various research applications, m-Xylene-d10 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations and the development of innovative chemical processes and products.
CAS Number | 116601-58-2 |
Molecular Formula | C8H10 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1,2,3,5-tetradeuterio-4,6-bis(trideuteriomethyl)benzene |
InChI | InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
InChIKey | IVSZLXZYQVIEFR-ZGYYUIRESA-N |
SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])[2H] |