For research use only. Not for therapeutic Use.
M-xylene (Cat.No: R062295) is one of the isomers of xylene. M-xylene is mainly used as a solvent to produce isophthalic acid and then produce unsaturated polyester resins and coatings. It is also used to produce m-methylbenzoic acid, isophthalonitrile, pharmaceutical lidocaine, oxymetazoline, new pan-shadow, etc.
| Catalog Number | R062295 |
| CAS Number | 108-38-3 |
| Synonyms | 1,3-Dimethylbenzene; 1,3-Xylene; 3-Methyltoluene; NSC 61769; m-Dimethylbenzene; m-Methyltoluene; m-xylol |
| Molecular Formula | C6H4(CH3)2 |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | 1,3-xylene |
| InChI | InChI=1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3 |
| InChIKey | IVSZLXZYQVIEFR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C |
