For research use only. Not for therapeutic Use.
M084(CAT: I031345) is a benzimidazole derivative known for its anti-aging effects in Caenorhabditis elegans. It functions by inhibiting mitochondrial respiration, which leads to the activation of the mitochondrial unfolded protein response (UPRmt) and AMPK, key regulators of cellular energy and stress responses. M084 also recruits the longevity-associated factors SIR-2.1 (a sirtuin) and SKN-1 (a homolog of Nrf2), which in turn activate DAF-16, a FOXO-family transcription factor central to lifespan extension. Through this coordinated network of stress signaling and metabolic regulation, M084 significantly delays aging in C. elegans, making it a valuable molecule in aging and mitochondrial research.
| CAS Number | 51314-51-3 |
| Synonyms | N-butyl-1H-benzimidazol-2-amine |
| Molecular Formula | C11H15N3 |
| Purity | ≥95% |
| IUPAC Name | N-butyl-1H-benzimidazol-2-amine |
| InChI | InChI=1S/C11H15N3/c1-2-3-8-12-11-13-9-6-4-5-7-10(9)14-11/h4-7H,2-3,8H2,1H3,(H2,12,13,14) |
| InChIKey | OKKUCNXCFWODOE-UHFFFAOYSA-N |
| SMILES | CCCCNC1=NC2=CC=CC=C2N1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
