For research use only. Not for therapeutic Use.
M1002（Cat No.:I031348）is a small molecule inhibitor that targets a specific protein involved in cellular processes such as growth, differentiation, and survival. It is primarily being investigated for its potential in treating cancers and autoimmune diseases by modulating key signaling pathways. M1002 has shown promise in preclinical studies for inhibiting tumor cell proliferation and suppressing inflammatory responses, making it a potential therapeutic option for conditions like rheumatoid arthritis and certain cancers. Ongoing research aims to evaluate its efficacy, safety, and mechanisms of action in clinical settings.
| CAS Number | 823830-85-9 |
| Synonyms | N-[3,5-bis(trifluoromethyl)phenyl]-1,1-dioxo-1,2-benzothiazol-3-amine |
| Molecular Formula | C15H8F6N2O2S |
| Purity | ≥95% |
| IUPAC Name | N-[3,5-bis(trifluoromethyl)phenyl]-1,1-dioxo-1,2-benzothiazol-3-amine |
| InChI | InChI=1S/C15H8F6N2O2S/c16-14(17,18)8-5-9(15(19,20)21)7-10(6-8)22-13-11-3-1-2-4-12(11)26(24,25)23-13/h1-7H,(H,22,23) |
| InChIKey | BMTRZTPPTZHACH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NS2(=O)=O)NC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
