For research use only. Not for therapeutic Use.
M1069(Cat No.:I042837)is a small molecule inhibitor that targets specific proteins or pathways involved in various cellular processes such as cell cycle regulation, signal transduction, and apoptosis. It has been studied for its potential in cancer therapy, particularly in inhibiting tumor growth and metastasis by blocking critical enzymes or receptors that drive cancer progression. M1069 is explored in preclinical research to evaluate its effects on tumor cells, including its ability to sensitize tumors to other treatments or therapies. Its precise mechanism of action continues to be studied for developing targeted therapies in oncology.
CAS Number | 3027658-65-4 |
Synonyms | (E)-but-2-enedioic acid;(5S)-N-[7-(3,6-dihydro-2H-pyran-4-yl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-2-yl]-7-oxa-2-azaspiro[4.5]decane-2-carboxamide |
Molecular Formula | C25H30N4O8S |
Purity | ≥95% |
IUPAC Name | (E)-but-2-enedioic acid;(5S)-N-[7-(3,6-dihydro-2H-pyran-4-yl)-4-methoxy-[1,3]thiazolo[4,5-c]pyridin-2-yl]-7-oxa-2-azaspiro[4.5]decane-2-carboxamide |
InChI | InChI=1S/C21H26N4O4S.C4H4O4/c1-27-18-16-17(15(11-22-18)14-3-9-28-10-4-14)30-19(23-16)24-20(26)25-7-6-21(12-25)5-2-8-29-13-21;5-3(6)1-2-4(7)8/h3,11H,2,4-10,12-13H2,1H3,(H,23,24,26);1-2H,(H,5,6)(H,7,8)/b;2-1+/t21-;/m0./s1 |
InChIKey | OMDWVJLHHMNGPD-SLISQCDCSA-N |
SMILES | COC1=NC=C(C2=C1N=C(S2)NC(=O)N3CC[C@]4(C3)CCCOC4)C5=CCOCC5.C(=C/C(=O)O)\C(=O)O |