For research use only. Not for therapeutic Use.
M2N12(Cat No.:I017828)is a synthetic peptide known for its role as a specific inhibitor of myosin light chain kinase (MLCK), an enzyme that regulates actin-myosin contraction through phosphorylation. By inhibiting MLCK, M2N12 affects cellular processes like smooth muscle contraction, cell motility, and cytoskeletal organization. It is widely used in research to study the regulation of the cytoskeleton, cellular migration, and muscle physiology. M2N12’s ability to modulate actin-myosin interactions makes it a valuable tool for investigating signal transduction pathways involved in various cellular and physiological functions.
CAS Number | 2376577-06-7 |
Molecular Formula | C₂₀H₁₆ClN₅O₂ |
Purity | ≥95% |
Target | CDK |
IUPAC Name | 6-chloro-7-[[1-[(4-methylphenyl)methyl]triazol-4-yl]methylamino]quinoline-5,8-dione |
InChI | InChI=1S/C20H16ClN5O2/c1-12-4-6-13(7-5-12)10-26-11-14(24-25-26)9-23-18-16(21)19(27)15-3-2-8-22-17(15)20(18)28/h2-8,11,23H,9-10H2,1H3 |
InChIKey | BDBIMDYALUJAPR-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)CN2C=C(N=N2)CNC3=C(C(=O)C4=C(C3=O)N=CC=C4)Cl |
Reference | [1]. Jing L, et al. Identification of highly potent and selective Cdc25 protein phosphatases inhibitors from miniaturization click-chemistry-based combinatorial libraries. Eur J Med Chem. 2019 Sep 14;183:111696. |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |