For research use only. Not for therapeutic Use.
(-)-Maackiain(Cat No.:M012893)is a naturally occurring pterocarpan, a subclass of isoflavonoids, found in legumes and other plants. Known for its potent biological activities, it exhibits antimicrobial, antifungal, and anti-inflammatory properties. (-)-Maackiain plays a significant role in plant defense mechanisms against pathogens and has drawn interest in medicinal chemistry for its potential therapeutic applications. Studies suggest its cytotoxic effects against cancer cells and its antioxidant capacity, which may protect against oxidative stress-related diseases. As a bioactive compound, (-)-Maackiain holds promise for pharmaceutical and agricultural research.
CAS Number | 19908-48-6 |
Molecular Formula | C16H12O5 |
Purity | ≥95% |
Target | Apoptosis |
Storage | Store at -20°C |
IUPAC Name | (1S,12S)-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol |
InChI | InChI=1S/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2/t11-,16-/m1/s1 |
InChIKey | HUKSJTUUSUGIDC-BDJLRTHQSA-N |
SMILES | C1[C@H]2[C@@H](C3=C(O1)C=C(C=C3)O)OC4=CC5=C(C=C24)OCO5 |