For research use only. Not for therapeutic Use.
(-)-Maackiain (Cat.No:M012893) is a natural isoflavone compound found in plants like Maackia amurensis. It exhibits various biological activities, including antioxidant, anti-inflammatory, and anticancer effects. (-)-Maackiain has attracted attention for its potential health benefits and is being studied for its role in promoting overall well-being and potentially preventing certain diseases.
| Catalog Number | M012893 |
| CAS Number | 19908-48-6 |
| Molecular Formula | C16H12O5 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | (1S,12S)-5,7,11,19-tetraoxapentacyclo[10.8.0.02,10.04,8.013,18]icosa-2,4(8),9,13(18),14,16-hexaen-16-ol |
| InChI | InChI=1S/C16H12O5/c17-8-1-2-9-12(3-8)18-6-11-10-4-14-15(20-7-19-14)5-13(10)21-16(9)11/h1-5,11,16-17H,6-7H2/t11-,16-/m1/s1 |
| InChIKey | HUKSJTUUSUGIDC-BDJLRTHQSA-N |
| SMILES | C1C2C(C3=C(O1)C=C(C=C3)O)OC4=CC5=C(C=C24)OCO5 |
