For research use only. Not for therapeutic Use.
Macromerine hydrochloride is an alkaloid.
| Catalog Number | I031445 |
| CAS Number | 51012-68-1 |
| Synonyms | (+/-)-Macromerine hydrochloride; (+/-)-Macromerine HCl; Macromerine hydrochloride; Macromerine HCl |
| Molecular Formula | C12H20ClNO3 |
| Purity | 98% |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | Benzenemethanol, alpha-((dimethylamino)methyl)-3,4-dimethoxy-, hydrochloride (1:1) |
| InChI | InChI=1S/C12H19NO3.ClH/c1-13(2)8-10(14)9-5-6-11(15-3)12(7-9)16-4;/h5-7,10,14H,8H2,1-4H3;1H |
| InChIKey | UXWIETBYRXIRRV-UHFFFAOYSA-N |
| SMILES | Cl.COc1ccc(cc1OC)C(O)CN(C)C |
