For research use only. Not for therapeutic Use.
Mafosfamide（Cat No.:I000009）is a potent oxazaphosphorine alkylating agent used in cancer research. As a prodrug of 4-hydroxycyclophosphamide, it undergoes metabolic activation to exert cytotoxic effects on rapidly dividing cells. Mafosfamide disrupts DNA replication and transcription, leading to apoptosis. It is particularly valuable in preclinical studies due to its efficacy against various tumor models. Researchers utilize mafosfamide to investigate new therapeutic strategies and understand resistance mechanisms. Its versatility and effectiveness make it an essential tool in the development of novel anti-cancer treatments.
| Catalog Number | I000009 |
| CAS Number | 88859-04-5 |
| Synonyms | Z-7557; Z7557; Z 7557; Mafosfamide |
| Molecular Formula | C9H19Cl2N2O5PS2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-[[2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinan-4-yl]sulfanyl]ethanesulfonic acid |
| InChI | InChI=1S/C9H19Cl2N2O5PS2/c10-2-4-13(5-3-11)19(14)12-9(1-6-18-19)20-7-8-21(15,16)17/h9H,1-8H2,(H,12,14)(H,15,16,17) |
| InChIKey | PBUUPFTVAPUWDE-UHFFFAOYSA-N |
| SMILES | C1COP(=O)(NC1SCCS(=O)(=O)O)N(CCCl)CCCl |
