For research use only. Not for therapeutic Use.
MAG-INDO 1-AM(Cat No.:M113715), based on the chemical structure provided, appears to be a complex synthetic compound featuring a benzene ring, multiple amine groups, and carboxylic acid groups. It includes four chloride ions, suggesting it may be used in salt form, possibly for increased solubility or stability. Such a molecule could be relevant in the development of pharmaceuticals or as a specialized reagent in biochemical assays.
Catalog Number | M113715 |
CAS Number | 130926-94-2 |
Molecular Formula | C30H32N2O12 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | acetyloxymethyl 2-[4-[bis[2-oxo-2-(2-oxopropoxymethoxy)ethyl]amino]phenyl]-1H-indole-6-carboxylate |
InChI | InChI=1S/C30H32N2O12/c1-19(33)14-39-16-42-28(36)12-32(13-29(37)43-17-40-15-20(2)34)25-8-6-22(7-9-25)26-10-23-4-5-24(11-27(23)31-26)30(38)44-18-41-21(3)35/h4-11,31H,12-18H2,1-3H3 |
InChIKey | XLQNJLJDRRJLCB-UHFFFAOYSA-N |
SMILES | CC(=O)COCOC(=O)CN(CC(=O)OCOCC(=O)C)C1=CC=C(C=C1)C2=CC3=C(N2)C=C(C=C3)C(=O)OCOC(=O)C |