For research use only. Not for therapeutic Use.
Magnesium(II) 2-ethylbutyrate is a coordination complex where magnesium (Mg²⁺) is bonded to two 2-ethylbutyrate anions. The 2-ethylbutyrate anion is derived from 2-ethylbutyric acid, which contains a branched alkyl chain with a carboxyl group. This compound is often used as a magnesium source in various chemical reactions and can serve as a catalyst or additive in organic synthesis. It may also be explored for its role in pharmaceutical formulations or as a precursor in the synthesis of magnesium-based materials or catalysts.
CAS Number | 79992-76-0 |
Molecular Formula | C12H22MgO4 |
Purity | ≥95% |
IUPAC Name | magnesium;2-ethylbutanoate |
InChI | InChI=1S/2C6H12O2.Mg/c2*1-3-5(4-2)6(7)8;/h2*5H,3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
InChIKey | JOADGALWHMAAKM-UHFFFAOYSA-L |
SMILES | CCC(CC)C(=O)[O-].CCC(CC)C(=O)[O-].[Mg+2] |