For research use only. Not for therapeutic Use.
Magnoflorine chloride(Cat No.:M013286) is an alkaloid compound found in various plant species, including Magnolia officinalis and Berberis species. Its mode of action and pharmacological effects can involve interactions with cellular receptors and enzymes due to its unique chemical structure. Magnoflorine chloride has been investigated for its potential bioactivities, including antioxidant, anti-inflammatory, and antimicrobial properties. It also exhibits vasodilatory effects and has been explored for its potential cardiovascular benefits. With applications in traditional medicine and potential modern therapeutic uses, magnoflorine chloride showcases its significance in natural product research and pharmaceutical development, offering avenues for investigating its potential in various health-related applications.
CAS Number | 6681-18-1 |
Synonyms | Magnoflorine, chloride;Nsc150443;(6aS)-5,6,6a,7-Tetrahydro-1,11-dihydroxy-2,10-dimethoxy-6,6-dimethyl-4H-dibenzo[de,g]quinolinium chloride;Corytuberine methochloride;Escholine chloride;Thalictrine chloride |
Molecular Formula | C20H24ClNO4 |
Purity | ≥95% |
Target | Fungal |
Storage | Room temperature |
IUPAC Name | (6aS)-2,10-dimethoxy-6,6-dimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-6-ium-1,11-diol;chloride |
InChI | InChI=1S/C20H23NO4.ClH/c1-21(2)8-7-12-10-15(25-4)20(23)18-16(12)13(21)9-11-5-6-14(24-3)19(22)17(11)18;/h5-6,10,13H,7-9H2,1-4H3,(H-,22,23);1H/t13-;/m0./s1 |
InChIKey | STVJLBTYWBXDBP-ZOWNYOTGSA-N |
SMILES | C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)O)OC)C.[Cl-] |