For research use only. Not for therapeutic Use.
MAHMA NONOate(Cat No.:M091133)is a nitric oxide (NO) donor compound commonly used in scientific research to study the role of nitric oxide in various physiological and pathological processes. It releases NO upon hydrolysis, allowing for controlled release and precise regulation of NO levels in biological systems. Nitric oxide is a critical signaling molecule involved in vascular relaxation, neurotransmission, immune response, and various cellular processes. MAHMA NONOate is used in studies related to cardiovascular health, neurobiology, and inflammation, helping researchers explore the therapeutic potential of modulating NO signaling in disease treatments.
CAS Number | 146724-86-9 |
Synonyms | (Z)-hydroxyimino-[methyl-[6-(methylamino)hexyl]amino]-oxidoazanium |
Molecular Formula | C8H20N4O2 |
Purity | ≥95% |
IUPAC Name | (Z)-hydroxyimino-[methyl-[6-(methylamino)hexyl]amino]-oxidoazanium |
InChI | InChI=1S/C8H20N4O2/c1-9-7-5-3-4-6-8-11(2)12(14)10-13/h9,13H,3-8H2,1-2H3/b12-10- |
InChIKey | KQHAZGURWZYZJG-BENRWUELSA-N |
SMILES | CNCCCCCCN(C)/[N+](=N/O)/[O-] |