For research use only. Not for therapeutic Use.
Makisterone A, a 28-carbon moulting hormone, has been identified as the major free pupal ecdysteroid in the honey bee, Apis mellifera[1].
| Catalog Number | R060998 |
| CAS Number | 20137-14-8 |
| Synonyms | (2S,3R,5R,9R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-17-[(2R,3R,5R)-2,3,6-trihydroxy-5,6-dimethylheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| Molecular Formula | C28H46O7 |
| Purity | ≥95% |
| InChI | InChI=1S/C28H46O7/c1-15(24(2,3)33)11-23(32)27(6,34)22-8-10-28(35)17-12-19(29)18-13-20(30)21(31)14-25(18,4)16(17)7-9-26(22,28)5/h12,15-16,18,20-23,30-35H,7-11,13-14H2,1-6H3/t15-,16+,18+,20-,21+,22+,23-,25-,26-,27-,28-/m1/s1 |
| InChIKey | IJRBORPEVKCEQD-JMQWOFAPSA-N |
| SMILES | CC(CC(C(C)(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)O)O)C(C)(C)O |
| Reference | [1]. M.F.Feldlaufer, et al. Makisterone A: The major ecdysteroid from the pupa of the honey bee, Apis mellifera. Insect Biochemistry. 1985, 15 (5):597-600. |
