For research use only. Not for therapeutic Use.
Mal-?PEG4-?propargyl is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Mal-?PEG4-?propargyl is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1].
| Catalog Number | I016145 |
| CAS Number | 1262681-30-0 |
| Synonyms | 1-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethyl]pyrrole-2,5-dione |
| Molecular Formula | C15H21NO6 |
| Purity | ≥95% |
| InChI | InChI=1S/C15H21NO6/c1-2-6-19-8-10-21-12-13-22-11-9-20-7-5-16-14(17)3-4-15(16)18/h1,3-4H,5-13H2 |
| InChIKey | HNIXCHONNFMINC-UHFFFAOYSA-N |
| SMILES | C#CCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| Reference | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
