For research use only. Not for therapeutic Use.
Mal-amido-PEG1-C2-NHS ester（Cat No.:I017854）is a chemical compound used primarily in bioconjugation and drug delivery applications. It consists of a polyethylene glycol (PEG) linker, which is attached to a maleimide group (Mal-amido) at one end and a reactive NHS ester group at the other. The NHS ester is highly reactive toward amines, enabling covalent attachment to proteins, peptides, or other biomolecules. This compound is useful for creating stable conjugates, such as antibody-drug conjugates (ADCs), for targeted drug delivery, improving solubility, and enhancing therapeutic efficacy while minimizing off-target effects.
| Catalog Number | I017854 |
| CAS Number | 1260092-50-9 |
| Molecular Formula | C₁₆H₁₉N₃O₈ |
| Purity | ≥95% |
| Target | ADC Linker |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]propanoate |
| InChI | InChI=1S/C16H19N3O8/c20-11(5-8-18-12(21)1-2-13(18)22)17-7-10-26-9-6-16(25)27-19-14(23)3-4-15(19)24/h1-2H,3-10H2,(H,17,20) |
| InChIKey | QXGYXAOYQWRQRZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCNC(=O)CCN2C(=O)C=CC2=O |
