For research use only. Not for therapeutic Use.
Mal-amido-PEG4-C2-acid is a PEG-based PROTAC linker commonly employed in the synthesis of Proteolysis Targeting Chimeras (PROTACs). It consists of a maleimide (Mal) group for selective conjugation with cysteine residues and an amido-PEG4-C2 spacer that imparts flexibility and hydrophilicity to the linker. The amido-PEG4-C2 segment allows for optimal positioning of the target-binding ligand and the protein degrader moiety. By connecting the ligand and the degrader through Mal-amido-PEG4-C2-acid, PROTACs can facilitate the targeted degradation of specific proteins, offering potential therapeutic applications in various diseases.
| Catalog Number | I017007 |
| CAS Number | 1263045-16-4 |
| Molecular Formula | C₁₈H₂₈N₂O₉ |
| Purity | ≥95% |
| Target | PROTAC Linkers |
| IUPAC Name | 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChI | InChI=1S/C18H28N2O9/c21-15(3-6-20-16(22)1-2-17(20)23)19-5-8-27-10-12-29-14-13-28-11-9-26-7-4-18(24)25/h1-2H,3-14H2,(H,19,21)(H,24,25) |
| InChIKey | IAJVEYLYYHOZEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCOCCOCCC(=O)O |
| Reference | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562. |
