For research use only. Not for therapeutic Use.
Mal-amido-PEG6-acid(Cat No.:I017010)is a functionalized polyethylene glycol (PEG) derivative commonly used in bioconjugation and drug delivery systems. The “Mal” refers to maleimide, a reactive group that can covalently bond with thiol groups in proteins, peptides, or other biomolecules, enabling targeted conjugation. The “amido” group provides a stable link between the maleimide and the PEG chain, while the “PEG6” indicates a six-unit polyethylene glycol spacer, enhancing solubility and reducing immunogenicity. The carboxylic acid group at the end of the molecule can be used for further conjugation or functionalization, making it useful for creating targeted therapeutic agents and diagnostic tools.
CAS Number | 1334177-79-5 |
Molecular Formula | C₂₂H₃₆N₂O₁₁ |
Purity | ≥95% |
Target | PROTAC Linkers |
IUPAC Name | 3-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
InChI | InChI=1S/C22H36N2O11/c25-19(3-6-24-20(26)1-2-21(24)27)23-5-8-31-10-12-33-14-16-35-18-17-34-15-13-32-11-9-30-7-4-22(28)29/h1-2H,3-18H2,(H,23,25)(H,28,29) |
InChIKey | WKTGEZMXNNBFEZ-UHFFFAOYSA-N |
SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCOCCOCCOCCOCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |