Mal-NH-ethyl-SS-propionic acid（Cat No.:I016118） is a cleavable ADC linker commonly employed in the synthesis of antibody-drug conjugates (ADCs). This linker incorporates a maleimide (Mal) group, an ethyl spacer, and a disulfide bond (SS). The maleimide group enables conjugation to thiol-containing molecules, such as cysteine residues on antibodies, while the disulfide bond allows for controlled release of the payload within target cells. By utilizing this linker, ADCs can effectively deliver cytotoxic drugs specifically to cancer cells, enhancing their therapeutic potential while minimizing off-target effects.
| Catalog Number | I016118 |
| CAS Number | 2128735-24-8 |
| Molecular Formula | C₁₂H₁₆N₂O₅S₂ |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyldisulfanyl]propanoic acid |
| InChI | InChI=1S/C12H16N2O5S2/c15-9(3-6-14-10(16)1-2-11(14)17)13-5-8-21-20-7-4-12(18)19/h1-2H,3-8H2,(H,13,15)(H,18,19) |
| InChIKey | MQYOVZAKKXDVHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCSSCCC(=O)O |
| Reference | [1]. Beck A, et al. Strategies and challenges for the next generation of antibody-drug conjugates. Nat Rev Drug Discov. 2017 May;16(5):315-337. |
