For research use only. Not for therapeutic Use.
Mal-PEG8-COOH(CAT: M032360) is a chemical compound used in bioconjugation and drug delivery systems. Its mode of action involves being a polyethylene glycol (PEG) derivative, with a maleimide (Mal) functional group and a carboxylic acid (COOH) group. This compound is often used as a linker or spacer in the preparation of targeted drug delivery systems and protein modifications. The maleimide group allows for specific conjugation with thiol groups on proteins or other biomolecules, enabling the creation of bioconjugates. Additionally, the PEG chain enhances the solubility and stability of the conjugates in biological systems.
CAS Number | 1334177-86-4 |
Molecular Formula | C26H44N2O13 |
Purity | ≥95% |
Target | ADC Linker |
Storage | Store at +4C |
IUPAC Name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
InChI | InChI=1S/C26H44N2O13/c29-23(3-6-28-24(30)1-2-25(28)31)27-5-8-35-10-12-37-14-16-39-18-20-41-22-21-40-19-17-38-15-13-36-11-9-34-7-4-26(32)33/h1-2H,3-22H2,(H,27,29)(H,32,33) |
InChIKey | ARKUDJPBDMAVBL-UHFFFAOYSA-N |
SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |