For research use only. Not for therapeutic Use.
Mal-VC-PAB-PNP（Cat No.:I042466）is a synthetic prodrug designed for targeted drug delivery, particularly in cancer therapy. It consists of a maleimide (Mal) group for conjugation to targeting molecules, a valine-citrulline (VC) peptide linker that is cleavable by certain enzymes, a para-aminobenzyl (PAB) group, and a para-nitrophenyl (PNP) moiety that acts as a leaving group. Upon enzymatic cleavage, the active drug is released at the targeted site, allowing for selective action. This structure enhances the therapeutic index, minimizing side effects while improving drug efficacy in tumor cells or other disease sites.
| CAS Number | 1096584-62-1 |
| Synonyms | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| Molecular Formula | C32H37N7O11 |
| Purity | ≥95% |
| IUPAC Name | [4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate |
| InChI | InChI=1S/C32H37N7O11/c1-19(2)28(37-25(40)15-17-38-26(41)13-14-27(38)42)30(44)36-24(4-3-16-34-31(33)45)29(43)35-21-7-5-20(6-8-21)18-49-32(46)50-23-11-9-22(10-12-23)39(47)48/h5-14,19,24,28H,3-4,15-18H2,1-2H3,(H,35,43)(H,36,44)(H,37,40)(H3,33,34,45)/t24-,28-/m0/s1 |
| InChIKey | WZLBRPXGGXMQRU-CUBQBAPOSA-N |
| SMILES | CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)CCN3C(=O)C=CC3=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
