For research use only. Not for therapeutic Use.
Malachite Green (Cat.No:M066928) is a synthetic dye with applications in various industries, including textiles, paper, and microscopy. It’s also utilized as an antifungal agent in aquaculture and as a biological stain.
| Catalog Number | M066928 |
| CAS Number | 10309-95-2 |
| Molecular Formula | C23H25N2+ |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| InChI | InChI=1S/C23H25N2/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4/h5-17H,1-4H3/q+1 |
| InChIKey | VFCNQNZNPKRXIT-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=CC=C3 |
